Systematic / IUPAC Name: (3R,4R)-3,4-Bis(4-hydroxy-3-methoxybenzyl)dihydro-2(3H)-furanone
ID: Reference7908
Other Names:
(-)-Matairesinol;
(8R,8'R)-(-)-Matairesinol;
Artigenin congener;
Max;
(3R,4R)-3,4-Bis(4-hydroxy-3-methoxybenzyl)dihydrofuran-2(3H)-one
; more
Formula: C20H22O6
Matairesinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 3 |
| No. of Spectra | 8283 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/9/2018 12:56:21 PM |
| InChI | InChI=1S/C20H22O6/c1-24-18-9-12(3-5-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-17(22)19(10-13)25-2/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1 |
| InChI Key | MATGKVZWFZHCLI-LSDHHAIUSA-N |
| Canonical SMILES | COC1=C(C=CC(=C1)CC2COC(=O)C2CC3=CC(=C(C=C3)O)OC)O |
| CAS | 580723 |
| Splash | |
| Other Names |
(-)-Matairesinol; (8R,8'R)-(-)-Matairesinol; Artigenin congener; Max; (3R,4R)-3,4-Bis(4-hydroxy-3-methoxybenzyl)dihydrofuran-2(3H)-one; (3R,4R)-3,4-Bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one; 2(3H)-Furanone, dihydro-3,4-bis((4-hydroxy-3-methoxyphenyl)methyl)-, (3R-trans-)-; 3R,4R)-3,4-Bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one; 3R,4R-Bis((4-hydroxy-3-methoxyphenyl)methyl)dihydro-2(3H)-furanone; Dibenzylbutyrolactone lignanolide; Dihydro-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]-(3R,4R)-2(3H)-furanone; Dihydro-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]-(3R-trans-)-2(3H)-furanone |
| DrugBank | DB04200 |
| Wikipedia | Matairesinol |
| ChemSpider | 106491 |
| ChemIDPlus | 000580723 |
| ChEMBL | CHEMBL425148 |
| ChEBI | CHEBI:6698 |
| PubChem | 119205 |
| KEGG | C10682 |
| HMDb | HMDB35698 |