Systematic / IUPAC Name: 2-(6-Hydroxyhexyl)-3-methylidenebutanedioic acid
ID: Reference7925
Other Names: Butanedioic acid, 2-(6-hydroxyhexyl)-3-methylene-
Formula: C11H18O5
2-(6-Hydroxyhexyl)-3-methylenesuccinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 87 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/11/2018 8:49:52 AM |
| InChI | InChI=1S/C11H18O5/c1-8(10(13)14)9(11(15)16)6-4-2-3-5-7-12/h9,12H,1-7H2,(H,13,14)(H,15,16) |
| InChI Key | DHVXMTMJTVCPBB-UHFFFAOYSA-N |
| Canonical SMILES | C=C(C(CCCCCCO)C(=O)O)C(=O)O |
| CAS | |
| Splash | |
| Other Names | Butanedioic acid, 2-(6-hydroxyhexyl)-3-methylene- |