Systematic / IUPAC Name: 4-({2-[(1E)-3-Hydroxy-1-buten-1-yl]-5-oxotetrahydro-3-furanyl}amino)benzaldehyde
ID: Reference7929
Other Names:
5-(3-Hydroxy-1-butenyl)-4-[(4-formylphenyl)amino]tetrahydro-2-furanone;
Benzaldehyde, 4-{[tetrahydro-2-(3-hydroxy-1-butenyl)-5-oxo-3-furanyl]amino}-
Formula: C15H17NO4
Obscurolide A2 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/11/2018 12:35:47 PM |
| InChI | InChI=1S/C15H17NO4/c1-10(18)2-7-14-13(8-15(19)20-14)16-12-5-3-11(9-17)4-6-12/h2-7,9-10,13-14,16,18H,8H2,1H3/b7-2+ |
| InChI Key | RYJWSNUDETVRFF-FARCUNLSSA-N |
| Canonical SMILES | CC(C=CC1C(CC(=O)O1)NC2=CC=C(C=C2)C=O)O |
| CAS | |
| Splash | |
| Other Names |
5-(3-Hydroxy-1-butenyl)-4-[(4-formylphenyl)amino]tetrahydro-2-furanone; Benzaldehyde, 4-{[tetrahydro-2-(3-hydroxy-1-butenyl)-5-oxo-3-furanyl]amino}- |
| ChemIDPlus | 144398005 |
| ChEMBL | CHEMBL1524556 |
| ChemSpider | 4578602 |
| PubChem | 5467708 |