Systematic / IUPAC Name: 4-Methyl-2-oxo-2H-chromen-7-yl acetate
ID: Reference7931
Other Names:
Hymecromone acetate;
β-Methylumbelliferyl acetate;
(4-Methyl-2-oxochromen-7-yl) acetate;
2H-1-Benzopyran-2-one, 7-(acetyloxy)-4-methyl-;
4-Methyl 7-acetoxy coumarine
; more
Formula: C12H10O4
4-Methylumbelliferyl acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/11/2018 12:38:51 PM |
| InChI | InChI=1S/C12H10O4/c1-7-5-12(14)16-11-6-9(15-8(2)13)3-4-10(7)11/h3-6H,1-2H3 |
| InChI Key | HXVZGASCDAGAPS-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC(=O)C |
| CAS | 2747059 |
| Splash | |
| Other Names |
Hymecromone acetate; β-Methylumbelliferyl acetate; (4-Methyl-2-oxochromen-7-yl) acetate; 2H-1-Benzopyran-2-one, 7-(acetyloxy)-4-methyl-; 4-Methyl 7-acetoxy coumarine; 4-Methyl-2-oxochromen-7-yl acetate; 4-Methyl-7-acetyloxy coumarin; 7-(Acetyloxy)-4-methyl-2H-1-benzopyran-2-one; 7-(Acetyloxy)-4-methyl-2-benzopyrone; 7-Acetoxy-4-methyl-2H-1-benzopyran-2-one; 7-Acetoxy-4-methylchromen-2-one; 7-Acetoxy-4-methylcoumarin; 7-Acetyl-4-methylcoumarin; Acetic acid 4-methyl-2-oxo-2H-chromen-7-yl ester; Acetic acid 4-methylumbelliferyl ester |
| ChEMBL | CHEMBL12019 |
| ChEBI | CHEBI:17763 |
| ChemIDPlus | 002747059; 2747059 |
| KEGG | C03837 |
| HMDb | HMDB32989 |
| ChemSpider | 359 |
| PubChem | 366 |