Systematic / IUPAC Name: 2-(2-Hydroxypropan-2-yl)-9-(3-methylbut-2-enyl)-2,3-dihydrofuro[3,2-g]chromen-7-one
ID: Reference7939
Other Names: 7H-Furo[3,2-g][1]benzopyran-7-one, 2,3-dihydro-2-(1-hydroxy-1-methylethyl)-9-(3-methyl-2-buten-1-yl)-
Formula: C19H22O4
2-(2-Hydroxy-2-propanyl)-9-(3-methyl-2-buten-1-yl)-2,3-dihydro-7H-furo[3,2-g]chromen-7-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/14/2018 10:00:14 AM |
| InChI | InChI=1S/C19H22O4/c1-11(2)5-7-14-17-12(6-8-16(20)23-17)9-13-10-15(19(3,4)21)22-18(13)14/h5-6,8-9,15,21H,7,10H2,1-4H3 |
| InChI Key | AOUZZRQCLQLQIF-UHFFFAOYSA-N |
| Canonical SMILES | CC(=CCC1=C2C(=CC3=C1OC(C3)C(C)(C)O)C=CC(=O)O2)C |
| CAS | |
| Splash | |
| Other Names | 7H-Furo[3,2-g][1]benzopyran-7-one, 2,3-dihydro-2-(1-hydroxy-1-methylethyl)-9-(3-methyl-2-buten-1-yl)- |