Systematic / IUPAC Name: (2S,3S)-2-(3,4-Dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydrochromen-4-one
ID: Reference7959
Other Names:
Fustin, (-)-;
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,7-dihydroxy-, (2S,3S)-
Formula: C15H12O6
(-)-Fustin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/15/2018 1:12:27 PM |
| InChI | InChI=1S/C15H12O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,14-18,20H/t14-,15+/m1/s1 |
| InChI Key | FNUPUYFWZXZMIE-CABCVRRESA-N |
| Canonical SMILES | C1=CC(=C(C=C1C2C(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O |
| CAS | |
| Splash | |
| Other Names |
Fustin, (-)-; 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,7-dihydroxy-, (2S,3S)- |