Systematic / IUPAC Name: 2-(5-Acetyl-2,3-dihydro-1-benzofuran-2-yl)prop-2-enyl 3-methylbutanoate
ID: Reference7973
Other Names: Butanoic acid, 3-methyl-, 2-(5-acetyl-2,3-dihydro-2-benzofuranyl)-2-propen-1-yl ester
Formula: C18H22O4
2-(5-Acetyl-2,3-dihydro-1-benzofuran-2-yl)-2-propen-1-yl 3-methylbutanoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/17/2018 7:17:18 AM |
| InChI | InChI=1S/C18H22O4/c1-11(2)7-18(20)21-10-12(3)17-9-15-8-14(13(4)19)5-6-16(15)22-17/h5-6,8,11,17H,3,7,9-10H2,1-2,4H3 |
| InChI Key | QKDHVEHKHGYWMD-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)CC(=O)OCC(=C)C1CC2=C(O1)C=CC(=C2)C(=O)C |
| CAS | |
| Splash | |
| Other Names | Butanoic acid, 3-methyl-, 2-(5-acetyl-2,3-dihydro-2-benzofuranyl)-2-propen-1-yl ester |