Systematic / IUPAC Name: (2R,3S,4S,5R,6S)-2-[(3,4,5-Trihydroxyoxan-2-yl)oxymethyl]-6-(3,4,5-trimethoxyphenoxy)oxane-3,4,5-triol
ID: Reference7984
Other Names: β-D-Glucopyranoside, 3,4,5-trimethoxyphenyl 6-O-pentopyranosyl-
Formula: C20H30O13
3,4,5-Trimethoxyphenyl 6-O-pentopyranosyl-β-D-glucopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1830 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/21/2018 12:15:57 PM |
| InChI | InChI=1S/C20H30O13/c1-27-10-4-8(5-11(28-2)18(10)29-3)32-20-17(26)15(24)14(23)12(33-20)7-31-19-16(25)13(22)9(21)6-30-19/h4-5,9,12-17,19-26H,6-7H2,1-3H3/t9?,12-,13?,14-,15+,16?,17-,19?,20-/m1/s1 |
| InChI Key | GGIDHIBVLYVTAU-QGPLIYBISA-N |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)OC2C(C(C(C(O2)COC3C(C(C(CO3)O)O)O)O)O)O |
| CAS | |
| Splash | |
| Other Names | β-D-Glucopyranoside, 3,4,5-trimethoxyphenyl 6-O-pentopyranosyl- |