Systematic / IUPAC Name: 5-Hex-3-yn-2-yl-1-methyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione
ID: Reference799
Other Names:
5-Allyl-5-(3-hexyn-2-yl)-1-methylbarbituric acid;
5-Allyl-1-methyl-5-(1-methyl-pent-2-ynyl)-pyrimidine-2,4,6-trione;
Barbituric acid, 5-allyl-1-methyl-5-(1-methyl-2-pentynyl)-;
1-Methyl-5-(1-methylpent-2-yn-1-yl)-5-(prop-2-en-1-yl)pyrimidine-2,4,6(1H,3H,5H)-trione;
Methohexitone
; more
Formula: C14H18N2O3
Class: Therapeutics/Prescription Drugs
Methohexital mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 107 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/10/2015 2:44:08 PM |
| InChI | InChI=1S/C14H18N2O3/c1-5-7-8-10(3)14(9-6-2)11(17)15-13(19)16(4)12(14)18/h6,10H,2,5,9H2,1,3-4H3,(H,15,17,19) |
| InChI Key | NZXKDOXHBHYTKP-UHFFFAOYSA-N |
| Canonical SMILES | CCC#CC(C)C1(C(=O)NC(=O)N(C1=O)C)CC=C |
| CAS | 115621335 |
| Splash | |
| Other Names |
5-Allyl-5-(3-hexyn-2-yl)-1-methylbarbituric acid; 5-Allyl-1-methyl-5-(1-methyl-pent-2-ynyl)-pyrimidine-2,4,6-trione; Barbituric acid, 5-allyl-1-methyl-5-(1-methyl-2-pentynyl)-; 1-Methyl-5-(1-methylpent-2-yn-1-yl)-5-(prop-2-en-1-yl)pyrimidine-2,4,6(1H,3H,5H)-trione; Methohexitone; Brevital; Brietal; Methodrexitone; Enallynymall; Enallynymalum |
| KEGG | C07844; D00712; D04985 |
| Wikipedia | Methohexital |
| ChemIDPlus | 000151837; 000309364; 018652932 |
| ChEMBL | CHEMBL7413 |
| DrugBank | APRD00058 |
| PubChem | 9034 |
| ChemSpider | 8683 |
| ChEBI | CHEBI:102216 |