Systematic / IUPAC Name: (6E)-8,9-Dihydroxy-2-oxo-10-propyl-3,4,5,8,9,10-hexahydro-2H-oxecin-3-yl (2E,4E)-2,4-hexadienoate
ID: Reference7997
Other Names: 2,4-Hexadienoic acid, (6E)-3,4,5,8,9,10-hexahydro-8,9-dihydroxy-2-oxo-10-propyl-2H-oxecin-3-yl ester, (2E,4E)-
Formula: C18H26O6
Pinolidoxin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 62 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/24/2018 6:03:07 AM |
| InChI | InChI=1S/C18H26O6/c1-3-5-6-12-16(20)23-15-11-8-7-10-13(19)17(21)14(9-4-2)24-18(15)22/h3,5-7,10,12-15,17,19,21H,4,8-9,11H2,1-2H3/b5-3+,10-7+,12-6+ |
| InChI Key | TXPRZPDVUZCNLB-YECGNMMBSA-N |
| Canonical SMILES | CCCC1C(C(C=CCCC(C(=O)O1)OC(=O)C=CC=CC)O)O |
| CAS | |
| Splash | |
| Other Names | 2,4-Hexadienoic acid, (6E)-3,4,5,8,9,10-hexahydro-8,9-dihydroxy-2-oxo-10-propyl-2H-oxecin-3-yl ester, (2E,4E)- |
| ChemSpider | 4444609 |
| ChEBI | CHEBI:8223 |
| KEGG | C08503 |
| PubChem | 5281169 |