Systematic / IUPAC Name: (2S)-2-Amino-3-phenylpropanoic acid
ID: Reference8
Other Names:
3-Phenyl-L-alanine;
3-Phenylalanine;
(S)-2-Amino-3-phenylpropionic acid;
(S)-Phenylalanine;
Phenylalanine, L-
; more
Formula: C9H11NO2
Class: Endogenous Metabolites
L-Phenylalanine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 656 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 10/10/2016 9:41:17 AM |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1 |
| InChI Key | COLNVLDHVKWLRT-QMMMGPOBSA-N |
| Canonical SMILES | c1ccc(cc1)CC(C(=O)O)N |
| CAS | 63912 |
| Splash | |
| Other Names |
3-Phenyl-L-alanine; 3-Phenylalanine; (S)-2-Amino-3-phenylpropionic acid; (S)-Phenylalanine; Phenylalanine, L-; (S)-α-Amino-β-phenylpropionic acid; Alanine, 3-phenyl-; (S)-2-Amino-3-phenylpropanoic acid; (S)-α-Aminohydrocinnamic acid; Alanine, phenyl-, L-; (S)-(-)-Phenylalanine; Hydrocinnamic acid, α-amino-; 2-Amino-3-phenylpropionic acid, L-; α-Aminohydrocinnamic acid, L-; α-Amino-β-phenylpropionic acid, L-; L-2-Amino-3-phenylpropionic acid; α-Aminohydrocinnamate; L-(-)-Phenylalanine; (S)-α-Aminohydrocinnamate; (S)-α-Aminobenzenepropanoic acid; L-Phe; Phe |
| WebBook | 2993892197 |
| ChemIDPlus | 000063912; 016480572; 026655914 |
| Wikipedia | Phenylalanine |
| ChEMBL | CHEMBL25080 |
| KEGG | C00079; D00021 |
| PubChem | 6140 |
| ChemSpider | 5910 |
| ChEBI | CHEBI:28044 |