Systematic / IUPAC Name: (3β,4α,8α)-12,13-Epoxytrichothec-9-ene-3,4,8,15-tetrol
ID: Reference8001
Other Names:
T-2 Tetraol;
(2R,2'S,3R,4S,5S,5aR,7S,9aR)-5a-(Hydroxymethyl)-5,8-dimethyl-2,3,4,5,5a,6,7,9a-octahydrospiro[2,5-methanobenzo[b]oxepine-10,2'-oxirane]-3,4,7-triol
Formula: C15H22O6
Trichothec-9-ene-3-α,4-β,8-α,15-tetrol, 12,13-epoxy- mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 143 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/28/2018 10:06:53 AM |
| InChI | InChI=1S/C15H22O6/c1-7-3-9-14(5-16,4-8(7)17)13(2)11(19)10(18)12(21-9)15(13)6-20-15/h3,8-12,16-19H,4-6H2,1-2H3/t8-,9+,10+,11+,12+,13+,14+,15-/m0/s1 |
| InChI Key | ZAXZBJSXSOISTF-LYFQSNBGSA-N |
| Canonical SMILES | CC1=CC2C(CC1O)(C3(C(C(C(C34CO4)O2)O)O)C)CO |
| CAS | |
| Splash | |
| Other Names |
T-2 Tetraol; (2R,2'S,3R,4S,5S,5aR,7S,9aR)-5a-(Hydroxymethyl)-5,8-dimethyl-2,3,4,5,5a,6,7,9a-octahydrospiro[2,5-methanobenzo[b]oxepine-10,2'-oxirane]-3,4,7-triol |
| ChEMBL | CHEMBL152377 |
| PubChem | 9904331 |
| ChemSpider | 8079985 |