Systematic / IUPAC Name: {(2R,3S,4S,5R,6R)-3,4,5-Trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl}methyl 2-methylbutanoate
ID: Reference8004
Other Names: α-D-Glucopyranoside, 6-O-(2-methyl-1-oxobutyl)-α-D-glucopyranosyl
Formula: C17H30O12
6-O-(2-Methylbutanoyl)-α-D-glucopyranosyl α-D-glucopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 288 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/28/2018 10:18:11 AM |
| InChI | InChI=1S/C17H30O12/c1-3-6(2)15(25)26-5-8-10(20)12(22)14(24)17(28-8)29-16-13(23)11(21)9(19)7(4-18)27-16/h6-14,16-24H,3-5H2,1-2H3/t6?,7-,8-,9-,10-,11+,12+,13-,14-,16-,17-/m1/s1 |
| InChI Key | XLVGCFIBECZCKR-NVGKCVISSA-N |
| Canonical SMILES | CCC(C)C(=O)OCC1C(C(C(C(O1)OC2C(C(C(C(O2)CO)O)O)O)O)O)O |
| CAS | |
| Splash | |
| Other Names | α-D-Glucopyranoside, 6-O-(2-methyl-1-oxobutyl)-α-D-glucopyranosyl |