Systematic / IUPAC Name: (5E)-2-Heptyl-3,4,7-trihydroxy-2,3,4,7,8,9-hexahydrooxecin-10-one
ID: Reference8010
Other Names: 2H-Oxecin-2-one, 10-heptyl-3,4,5,8,9,10-hexahydro-5,8,9-trihydroxy-, (6E)-
Formula: C16H28O5
(6E)-10-Heptyl-5,8,9-trihydroxy-3,4,5,8,9,10-hexahydro-2H-oxecin-2-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 418 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/31/2018 8:32:39 AM |
| InChI | InChI=1S/C16H28O5/c1-2-3-4-5-6-7-14-16(20)13(18)10-8-12(17)9-11-15(19)21-14/h8,10,12-14,16-18,20H,2-7,9,11H2,1H3/b10-8+ |
| InChI Key | NGMQJZCKXKTQID-CSKARUKUSA-N |
| Canonical SMILES | CCCCCCCC1C(C(C=CC(CCC(=O)O1)O)O)O |
| CAS | |
| Splash | |
| Other Names | 2H-Oxecin-2-one, 10-heptyl-3,4,5,8,9,10-hexahydro-5,8,9-trihydroxy-, (6E)- |