Systematic / IUPAC Name: (E)-3-Hydroxy-2,4-dimethylhept-4-enamide
ID: Reference8012
Other Names: 4-Heptenamide, 3-hydroxy-2,4-dimethyl-, (4E)-
Formula: C9H17NO2
(4E)-3-Hydroxy-2,4-dimethyl-4-heptenamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/31/2018 8:51:47 AM |
| InChI | InChI=1S/C9H17NO2/c1-4-5-6(2)8(11)7(3)9(10)12/h5,7-8,11H,4H2,1-3H3,(H2,10,12)/b6-5+ |
| InChI Key | KYKBHRVKONYRBO-AATRIKPKSA-N |
| Canonical SMILES | CCC=C(C)C(C(C)C(=O)N)O |
| CAS | |
| Splash | |
| Other Names | 4-Heptenamide, 3-hydroxy-2,4-dimethyl-, (4E)- |