Systematic / IUPAC Name: 2-{(E)-[4-(Dimethylamino)phenyl]diazenyl}benzoic acid
ID: Reference802
Other Names:
Acid red-2;
o-{[p-(Dimethylamino)phenyl]azo}benzoic acid ;
o-Methyl red;
p-(Dimethylamino)azobenzene-o-carboxylic acid;
2-(4-Dimethylaminophenylazo)benzoic acid
; more
Formula: C15H15N3O2
Class: Industrial Chemicals
Methyl red mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/12/2016 11:47:57 AM |
| InChI | InChI=1S/C15H15N3O2/c1-18(2)12-9-7-11(8-10-12)16-17-14-6-4-3-5-13(14)15(19)20/h3-10H,1-2H3,(H,19,20)/b17-16+ |
| InChI Key | CEQFOVLGLXCDCX-WUKNDPDISA-N |
| Canonical SMILES | |
| CAS | 493527 |
| Splash | |
| Other Names |
Acid red-2; o-{[p-(Dimethylamino)phenyl]azo}benzoic acid ; o-Methyl red; p-(Dimethylamino)azobenzene-o-carboxylic acid; 2-(4-Dimethylaminophenylazo)benzoic acid; 2-[(p-Dimethylamino)phenyl]azobenzoic acid; 2-{[4-(Dimethylamino)phenyl]azo}benzoic acid ; Benzoic acid, o-{[p-(dimethylamino)phenyl]azo}- ; Benzoic acid, 2-[(4-dimethylamino)phenylazo]-; Benzoic acid, 2-{[4-(dimethylamino)phenyl]azo}- |
| Wikipedia | Methyl red |
| PubChem | 10303 |
| KEGG | C19459 |
| ChemSpider | 9881 |
| ChEMBL | CHEMBL1090439 |