Systematic / IUPAC Name: 8-(2-Hydroxy-1-methoxy-3-methyl-3-buten-1-yl)-7-methoxy-2H-chromen-2-one
ID: Reference8021
Other Names:
7-Methoxy-8-(1'-methoxy-2'-hydroxy-3-methyl-3'-butenyl)coumarin;
2H-1-Benzopyran-2-one, 8-(2-hydroxy-1-methoxy-3-methyl-3-buten-1-yl)-7-methoxy-
Formula: C16H18O5
Albiflorin-3 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3407 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/1/2018 10:32:50 AM |
| InChI | InChI=1S/C16H18O5/c1-9(2)14(18)16(20-4)13-11(19-3)7-5-10-6-8-12(17)21-15(10)13/h5-8,14,16,18H,1H2,2-4H3 |
| InChI Key | DBPWCIPDCMVUFT-UHFFFAOYSA-N |
| Canonical SMILES | CC(=C)C(C(C1=C(C=CC2=C1OC(=O)C=C2)OC)OC)O |
| CAS | |
| Splash | |
| Other Names |
7-Methoxy-8-(1'-methoxy-2'-hydroxy-3-methyl-3'-butenyl)coumarin; 2H-1-Benzopyran-2-one, 8-(2-hydroxy-1-methoxy-3-methyl-3-buten-1-yl)-7-methoxy- |