Systematic / IUPAC Name: Dimethyl 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate
ID: Reference8025
Other Names: 1,3-Cyclobutanedicarboxylic acid, 2,4-bis(4-hydroxyphenyl)-, dimethyl ester
Formula: C20H20O6
Dimethyl 2,4-bis(4-hydroxyphenyl)-1,3-cyclobutanedicarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 438 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/1/2018 12:44:15 PM |
| InChI | InChI=1S/C20H20O6/c1-25-19(23)17-15(11-3-7-13(21)8-4-11)18(20(24)26-2)16(17)12-5-9-14(22)10-6-12/h3-10,15-18,21-22H,1-2H3 |
| InChI Key | OEWCQSJKSNWJTH-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1C(C(C1C2=CC=C(C=C2)O)C(=O)OC)C3=CC=C(C=C3)O |
| CAS | |
| Splash | |
| Other Names | 1,3-Cyclobutanedicarboxylic acid, 2,4-bis(4-hydroxyphenyl)-, dimethyl ester |