Systematic / IUPAC Name: (4-{[4-(Dimethylamino)phenyl]phenylmethylidene}cyclohexa-2,5-dien-1-ylidene)dimethylazanium
ID: Reference805
Other Names:
Basic green;
Burma green B;
Calcozine green V;
Diamond green B extra;
Fast green O
; more
Formula: C23H25N2 +
Class: Industrial Chemicals
Malachite green mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 190 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/27/2016 5:35:43 AM |
| InChI | InChI=1S/C23H25N2/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4/h5-17H,1-4H3/q+1 |
| InChI Key | VFCNQNZNPKRXIT-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=CC=C3 |
| CAS | 569642 |
| Splash | |
| Other Names |
Basic green; Burma green B; Calcozine green V; Diamond green B extra; Fast green O; Green MX; Grenoble green; Malachite green; Victoria green B ; 4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium; Ammonium, {4-[p-(dimethylamino)-α-phenylbenzylidene]-2,5-cyclohexadien-1-ylidene}dimethyl- ; Methanaminium, N-(4-{[4-(dimethylamino)phenyl]phenylmethylene}-2,5-cyclohexadien-1-ylidene)-N-methyl- |
| PubChem | 11295 |
| ChEBI | CHEBI:44107 |
| ChemSpider | 10821 |
| ChEMBL | CHEMBL1181633 |
| ChemIDPlus | 010309952; 061725506 |