Systematic / IUPAC Name: (2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-(3,4,5-trimethoxyphenoxy)oxane-3,4,5-triol
ID: Reference8079
Other Names:
Koaburaside monomethyl ether;
Koaburside
Formula: C15H22O9
3,4,5-Trimethoxyphenyl β-D-glucopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/15/2018 11:02:56 AM |
| InChI | InChI=1S/C15H22O9/c1-20-8-4-7(5-9(21-2)14(8)22-3)23-15-13(19)12(18)11(17)10(6-16)24-15/h4-5,10-13,15-19H,6H2,1-3H3/t10-,11-,12+,13-,15-/m1/s1 |
| InChI Key | NBLLRWANAFOKON-ZHZXCYKASA-N |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)OC2C(C(C(C(O2)CO)O)O)O |
| CAS | |
| Splash | |
| Other Names |
Koaburaside monomethyl ether; Koaburside |
| ChEMBL | CHEMBL469618 |
| ChemSpider | 552229 |
| PubChem | 636454 |
| ChEBI | CHEBI:68966 |