Systematic / IUPAC Name: (3E)-4-(1-Hydroxy-2,2,6-trimethyl-4-oxocyclohexyl)-3-buten-2-yl hexopyranoside
ID: Reference8096
Other Names: Cyclohexanone, 4-[(1E)-3-(hexopyranosyloxy)-1-buten-1-yl]-4-hydroxy-3,3,5-trimethyl-
Formula: C19H32O8
Dihydroroseoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/19/2018 9:12:11 AM |
| InChI | InChI=1S/C19H32O8/c1-10-7-12(21)8-18(3,4)19(10,25)6-5-11(2)26-17-16(24)15(23)14(22)13(9-20)27-17/h5-6,10-11,13-17,20,22-25H,7-9H2,1-4H3/b6-5+ |
| InChI Key | QFTPTUOKFIIFJH-AATRIKPKSA-N |
| Canonical SMILES | CC1CC(=O)CC(C1(C=CC(C)OC2C(C(C(C(O2)CO)O)O)O)O)(C)C |
| CAS | |
| Splash | |
| Other Names | Cyclohexanone, 4-[(1E)-3-(hexopyranosyloxy)-1-buten-1-yl]-4-hydroxy-3,3,5-trimethyl- |