Systematic / IUPAC Name: 2-Methyl-1,2,3,4,10,14β-hexahydrodibenzo[c,f]pyrazino[1,2-a]azepine
ID: Reference810
Other Names:
Dibenzo[c,f]pyrazino[1,2-a]azepine, 1,2,3,4,10,14b-hexahydro-2-methyl-;
Mianserine;
Tolvon
Formula: C18H20N2
Class: Therapeutics/Prescription Drugs
Mianserin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 185 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/11/2015 11:12:09 AM |
| InChI | InChI=1S/C18H20N2/c1-19-10-11-20-17-9-5-3-7-15(17)12-14-6-2-4-8-16(14)18(20)13-19/h2-9,18H,10-13H2,1H3 |
| InChI Key | UEQUQVLFIPOEMF-UHFFFAOYSA-N |
| Canonical SMILES | CN1CCN2C(C1)C3=CC=CC=C3CC4=CC=CC=C42 |
| CAS | 24219974 |
| Splash | |
| Other Names |
Dibenzo[c,f]pyrazino[1,2-a]azepine, 1,2,3,4,10,14b-hexahydro-2-methyl-; Mianserine; Tolvon |
| Wikipedia | Mianserin |
| ChemIDPlus | 024219974 |
| ChEBI | CHEBI:51137 |
| ChEMBL | CHEMBL6437 |
| ChemSpider | 4040 |
| KEGG | D08216 |
| PubChem | 4184 |