Systematic / IUPAC Name: 4-[(1E)-3-Hydroxy-1-propen-1-yl]-2-methoxyphenyl β-D-glucopyranoside
ID: Reference8104
Other Names:
(E)-Coniferin;
Abietin;
Coniferoside;
Coniferyl alcohol β-δ-glucoside;
Coniferyl alcohol β-D-glucoside
; more
Formula: C16H22O8
Coniferin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 215 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/20/2018 11:31:49 AM |
| InChI | InChI=1S/C16H22O8/c1-22-11-7-9(3-2-6-17)4-5-10(11)23-16-15(21)14(20)13(19)12(8-18)24-16/h2-5,7,12-21H,6,8H2,1H3/b3-2+/t12-,13-,14+,15-,16-/m1/s1 |
| InChI Key | SFLMUHDGSQZDOW-FAOXUISGSA-N |
| Canonical SMILES | COC1=C(C=CC(=C1)C=CCO)OC2C(C(C(C(O2)CO)O)O)O |
| CAS | 531293 |
| Splash | |
| Other Names |
(E)-Coniferin; Abietin; Coniferoside; Coniferyl alcohol β-δ-glucoside; Coniferyl alcohol β-D-glucoside; Coniferyl alcohol-4-O-β-D-glucopyranoside; Laricin; β-D-Glucopyranoside, 4-(3-hydroxy-1-propenyl)-2-methoxyphenyl (van); (2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-[4-[(E)-3-hydroxyprop-1-enyl]-2-methoxyphenoxy]oxane-3,4,5-triol; 4-(3-Hydroxyprop-1-en-1-yl)-2-methoxyphenyl β-δ-glucopyranoside; 4-(3-Hydroxyprop-1-en-1-yl)-2-methoxyphenyl β-D-glucopyranoside |
| ChemSpider | 4444067 |
| HMDb | HMDB13682 |
| ChemIDPlus | 000531293 |
| ChEMBL | CHEMBL459056 |
| KEGG | C00761 |
| PubChem | 5280372 |
| Wikipedia | Coniferin |
| ChEBI | CHEBI:16220 |