Systematic / IUPAC Name: 3-{4-Methoxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl}propanoic acid
ID: Reference8105
Other Names: Benzenepropanoic acid, 2-(β-D-glucopyranosyloxy)-4-methoxy-
Formula: C16H22O9
3-[2-(β-D-Glucopyranosyloxy)-4-methoxyphenyl]propanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/20/2018 12:20:01 PM |
| InChI | InChI=1S/C16H22O9/c1-23-9-4-2-8(3-5-12(18)19)10(6-9)24-16-15(22)14(21)13(20)11(7-17)25-16/h2,4,6,11,13-17,20-22H,3,5,7H2,1H3,(H,18,19)/t11-,13-,14+,15-,16-/m1/s1 |
| InChI Key | LIVNOUBJFOXZOR-YMILTQATSA-N |
| Canonical SMILES | COC1=CC(=C(C=C1)CCC(=O)O)OC2C(C(C(C(O2)CO)O)O)O |
| CAS | |
| Splash | |
| Other Names | Benzenepropanoic acid, 2-(β-D-glucopyranosyloxy)-4-methoxy- |