Systematic / IUPAC Name: [(2R,3R,4S,5R,6S)-2-(Hydroxymethyl)-4,5,6-tris[(3,4,5-trihydroxybenzoyl)oxy]oxan-3-yl] 3,4,5-trihydroxybenzoate
ID: Reference8108
Other Names: β-D-Glucopyranose, 1,2,3,4-tetrakis(3,4,5-trihydroxybenzoate)
Formula: C34H28O22
1,2,3,4-Tetrakis-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranose mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 155 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/25/2018 8:34:55 AM |
| InChI | InChI=1S/C34H28O22/c35-9-22-27(53-30(48)10-1-14(36)23(44)15(37)2-10)28(54-31(49)11-3-16(38)24(45)17(39)4-11)29(55-32(50)12-5-18(40)25(46)19(41)6-12)34(52-22)56-33(51)13-7-20(42)26(47)21(43)8-13/h1-8,22,27-29,34-47H,9H2/t22-,27-,28+,29-,34+/m1/s1 |
| InChI Key | XFLTYUCKJRFDOU-XPMKZLBQSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | β-D-Glucopyranose, 1,2,3,4-tetrakis(3,4,5-trihydroxybenzoate) |