Systematic / IUPAC Name: 6,7-Dimethoxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one
ID: Reference8134
Other Names: 2H-1-Benzopyran-2-one, 8-(β-D-glucopyranosyloxy)-6,7-dimethoxy-
Formula: C17H20O10
6,7-Dimethoxy-2-oxo-2H-chromen-8-yl β-D-glucopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 155 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/7/2018 7:24:27 AM |
| InChI | InChI=1S/C17H20O10/c1-23-8-5-7-3-4-10(19)26-14(7)16(15(8)24-2)27-17-13(22)12(21)11(20)9(6-18)25-17/h3-5,9,11-13,17-18,20-22H,6H2,1-2H3/t9-,11-,12+,13-,17+/m1/s1 |
| InChI Key | MLOMRDQPPYHSAX-QSDFBURQSA-N |
| Canonical SMILES | COC1=C(C(=C2C(=C1)C=CC(=O)O2)OC3C(C(C(C(O3)CO)O)O)O)OC |
| CAS | |
| Splash | |
| Other Names | 2H-1-Benzopyran-2-one, 8-(β-D-glucopyranosyloxy)-6,7-dimethoxy- |