Systematic / IUPAC Name: (2R)-2-Phenyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetamide
ID: Reference8149
Other Names: Benzeneacetamide, α-(β-D-glucopyranosyloxy)-, (αR)-
Formula: C14H19NO7
(2R)-2-(β-D-Glucopyranosyloxy)-2-phenylacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 80 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/17/2018 12:38:26 PM |
| InChI | InChI=1S/C14H19NO7/c15-13(20)12(7-4-2-1-3-5-7)22-14-11(19)10(18)9(17)8(6-16)21-14/h1-5,8-12,14,16-19H,6H2,(H2,15,20)/t8-,9-,10+,11-,12-,14+/m1/s1 |
| InChI Key | SKIWWRXWLIRPOP-SGYGPSCOSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(C(=O)N)OC2C(C(C(C(O2)CO)O)O)O |
| CAS | |
| Splash | |
| Other Names | Benzeneacetamide, α-(β-D-glucopyranosyloxy)-, (αR)- |