Systematic / IUPAC Name: (4-Hydroxyphenyl)-[2,4,6-trihydroxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methanone
ID: Reference8158
Other Names:
Iriflophenone 3-C-β-D-glucopyranoside;
Methanone, (3-b-D-glucopyranosyl-2,4,6-trihydroxyphenyl)(4-hydroxyphenyl)-
Formula: C19H20O10
(1S)-1,5-Anhydro-1-[2,4,6-trihydroxy-3-(4-hydroxybenzoyl)phenyl]-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 155 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/21/2018 8:32:30 AM |
| InChI | InChI=1S/C19H20O10/c20-6-11-15(25)17(27)18(28)19(29-11)13-10(23)5-9(22)12(16(13)26)14(24)7-1-3-8(21)4-2-7/h1-5,11,15,17-23,25-28H,6H2/t11-,15-,17+,18-,19+/m1/s1 |
| InChI Key | BZYKNVLTMWYEFA-ZJKJAXBQSA-N |
| Canonical SMILES | C1=CC(=CC=C1C(=O)C2=C(C(=C(C=C2O)O)C3C(C(C(C(O3)CO)O)O)O)O)O |
| CAS | 104669025 |
| Splash | |
| Other Names |
Iriflophenone 3-C-β-D-glucopyranoside; Methanone, (3-b-D-glucopyranosyl-2,4,6-trihydroxyphenyl)(4-hydroxyphenyl)- |
| ChEMBL | CHEMBL3358632 |
| ChemSpider | 160291 |
| PubChem | 184358 |
| ChemIDPlus | 104669025 |