Systematic / IUPAC Name: 1,3,6-Trihydroxy-5-methoxy-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]xanthen-9-one
ID: Reference8166
Other Names:
D-Glucitol, 1,5-anhydro-1-C-(1,3,6-trihydroxy-5-methoxy-9-oxo-9H-xanthen-2-yl)-, (1S)-;
(1S)-1,5-Anhydro-1-(1,3,6-trihydroxy-5-methoxy-9-oxo-9H-xanthen-2-yl)-D-glucitol
Formula: C20H20O11
Irisxanthone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 155 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/22/2018 10:36:43 AM |
| InChI | InChI=1S/C20H20O11/c1-29-19-7(22)3-2-6-13(24)12-9(30-18(6)19)4-8(23)11(15(12)26)20-17(28)16(27)14(25)10(5-21)31-20/h2-4,10,14,16-17,20-23,25-28H,5H2,1H3/t10-,14-,16+,17-,20+/m1/s1 |
| InChI Key | MTQVPZUZBBTLNO-HSLVGEKZSA-N |
| Canonical SMILES | COC1=C(C=CC2=C1OC3=CC(=C(C(=C3C2=O)O)C4C(C(C(C(O4)CO)O)O)O)O)O |
| CAS | 51419568 |
| Splash | |
| Other Names |
D-Glucitol, 1,5-anhydro-1-C-(1,3,6-trihydroxy-5-methoxy-9-oxo-9H-xanthen-2-yl)-, (1S)-; (1S)-1,5-Anhydro-1-(1,3,6-trihydroxy-5-methoxy-9-oxo-9H-xanthen-2-yl)-D-glucitol |
| ChemSpider | 4444956 |
| PubChem | 5281637 |
| ChEBI | CHEBI:5973 |
| KEGG | C10067 |