Systematic / IUPAC Name: Methyl (1S,4aS,5S,6S,7R,7aS)-1-(β-D-glucopyranosyloxy)-5,6,7-trihydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
ID: Reference8172
Other Names: Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-5,6,7-trihydroxy-7-methyl-, methyl ester, (1S,4aS,5S,6S,7R,7aS)-
Formula: C17H26O12
Lamalbid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 155 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/23/2018 10:37:20 AM |
| InChI | InChI=1S/C17H26O12/c1-17(25)8-7(10(20)13(17)23)5(14(24)26-2)4-27-15(8)29-16-12(22)11(21)9(19)6(3-18)28-16/h4,6-13,15-16,18-23,25H,3H2,1-2H3/t6-,7-,8-,9-,10+,11+,12-,13+,15+,16+,17-/m1/s1 |
| InChI Key | HHDWDLBSGSYIQQ-GNDDPXJISA-N |
| Canonical SMILES | CC1(C2C(C(C1O)O)C(=COC2OC3C(C(C(C(O3)CO)O)O)O)C(=O)OC)O |
| CAS | 52212870 |
| Splash | |
| Other Names | Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-5,6,7-trihydroxy-7-methyl-, methyl ester, (1S,4aS,5S,6S,7R,7aS)- |
| ChEMBL | CHEMBL1079619 |
| ChemSpider | 10272896 |
| PubChem | 21637592 |