Systematic / IUPAC Name: 1-[2-Hydroxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethanone
ID: Reference8187
Other Names: Ethanone, 1-[4-(β-D-glucopyranosyloxy)-2-hydroxy-6-methylphenyl]-
Formula: C15H20O8
4-Acetyl-3-hydroxy-5-methylphenyl β-D-glucopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1107 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/3/2018 8:04:21 AM |
| InChI | InChI=1S/C15H20O8/c1-6-3-8(4-9(18)11(6)7(2)17)22-15-14(21)13(20)12(19)10(5-16)23-15/h3-4,10,12-16,18-21H,5H2,1-2H3/t10-,12-,13+,14-,15-/m1/s1 |
| InChI Key | CFJLERBDXYGARW-TVKJYDDYSA-N |
| Canonical SMILES | CC1=CC(=CC(=C1C(=O)C)O)OC2C(C(C(C(O2)CO)O)O)O |
| CAS | |
| Splash | |
| Other Names | Ethanone, 1-[4-(β-D-glucopyranosyloxy)-2-hydroxy-6-methylphenyl]- |