Systematic / IUPAC Name: (2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-[4-prop-2-enyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxy]oxane-3,4,5-triol
ID: Reference8196
Other Names: β-D-Glucopyranoside, 2-(β-D-glucopyranosyloxy)-4-(2-propen-1-yl)phenyl
Formula: C21H30O12
4-Allyl-2-(β-D-glucopyranosyloxy)phenyl β-D-glucopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 155 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/10/2018 6:11:39 AM |
| InChI | InChI=1S/C21H30O12/c1-2-3-9-4-5-10(30-20-18(28)16(26)14(24)12(7-22)32-20)11(6-9)31-21-19(29)17(27)15(25)13(8-23)33-21/h2,4-6,12-29H,1,3,7-8H2/t12-,13-,14-,15-,16+,17+,18-,19-,20-,21-/m1/s1 |
| InChI Key | SFQLDKSMEHBZRN-LWZURRPWSA-N |
| Canonical SMILES | C=CCC1=CC(=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O)OC3C(C(C(C(O3)CO)O)O)O |
| CAS | |
| Splash | |
| Other Names | β-D-Glucopyranoside, 2-(β-D-glucopyranosyloxy)-4-(2-propen-1-yl)phenyl |
| ChemSpider | 22913447 |
| PubChem | 23757231 |
| ChEMBL | CHEMBL3326613 |