Systematic / IUPAC Name: 4-Allylphenyl 6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside
ID: Reference8205
Other Names:
β-D-Glucopyranoside, 4-(2-propen-1-yl)phenyl 6-O-(6-deoxy-α-L-mannopyranosyl)-;
(2S,3R,4R,5R,6R)-2-Methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-prop-2-enylphenoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol
Formula: C21H30O10
Lusitanicoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 105 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/13/2018 9:09:36 AM |
| InChI | InChI=1S/C21H30O10/c1-3-4-11-5-7-12(8-6-11)30-21-19(27)17(25)15(23)13(31-21)9-28-20-18(26)16(24)14(22)10(2)29-20/h3,5-8,10,13-27H,1,4,9H2,2H3/t10-,13+,14-,15+,16+,17-,18+,19+,20+,21+/m0/s1 |
| InChI Key | DAELTTGCCPRYTP-ZLQZEYEISA-N |
| Canonical SMILES | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC=C(C=C3)CC=C)O)O)O)O)O)O |
| CAS | |
| Splash | |
| Other Names |
β-D-Glucopyranoside, 4-(2-propen-1-yl)phenyl 6-O-(6-deoxy-α-L-mannopyranosyl)-; (2S,3R,4R,5R,6R)-2-Methyl-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-prop-2-enylphenoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol |
| PubChem | 442799 |
| ChemSpider | 391127 |
| KEGG | C10474 |
| ChEBI | CHEBI:6575 |