Systematic / IUPAC Name: (2R,3S,4S,5R,6R)-2-[[(2R,3R,4R)-3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[4-(4-hydroxyphenyl)butan-2-yloxy]oxane-3,4,5-triol
ID: Reference8255
Other Names: β-D-Glucopyranoside, 3-(4-hydroxyphenyl)-1-methylpropyl 6-O-[(4ξ)-α-L-threo-pentofuranosyl]-
Formula: C21H32O11
4-(4-Hydroxyphenyl)-2-butanyl 6-O-[(4ξ)-α-L-threo-pentofuranosyl]-β-D-glucopyranoside mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 4 |
| No. of Spectra | 3012 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/23/2018 1:05:59 PM |
| InChI | InChI=1S/C21H32O11/c1-10(2-3-11-4-6-12(23)7-5-11)30-21-19(28)17(26)16(25)14(32-21)9-29-20-18(27)15(24)13(8-22)31-20/h4-7,10,13-28H,2-3,8-9H2,1H3/t10?,13?,14-,15+,16-,17+,18-,19-,20-,21-/m1/s1 |
| InChI Key | DJDISCKFJXDADJ-COUYJTLKSA-N |
| Canonical SMILES | CC(CCC1=CC=C(C=C1)O)OC2C(C(C(C(O2)COC3C(C(C(O3)CO)O)O)O)O)O |
| CAS | |
| Splash | |
| Other Names | β-D-Glucopyranoside, 3-(4-hydroxyphenyl)-1-methylpropyl 6-O-[(4ξ)-α-L-threo-pentofuranosyl]- |