Systematic / IUPAC Name: 1-(9-Azabicyclo[4.2.1]non-4-en-5-yl)propan-1-one
ID: Reference8285
Other Names: 1-(9-Azabicyclo[4.2.1]non-2-en-2-yl)-1-propanone
Formula: C11H17NO
Class: Natural Toxins
Homo-anatoxin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1466 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/30/2018 7:26:09 AM |
| InChI | InChI=1S/C11H17NO/c1-2-11(13)9-5-3-4-8-6-7-10(9)12-8/h5,8,10,12H,2-4,6-7H2,1H3 |
| InChI Key | VVMQRZZXKNDPOT-UHFFFAOYSA-N |
| Canonical SMILES | CCC(=O)C1=CCCC2CCC1N2 |
| CAS | |
| Splash | |
| Other Names | 1-(9-Azabicyclo[4.2.1]non-2-en-2-yl)-1-propanone |