Systematic / IUPAC Name: (2-Amino-5,10,10-trihydroxy-6-imino-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl)methoxycarbonylsulfamic acid
ID: Reference8286
Other Names:
Carbamic acid, N-sulfo-, (octahydro-5,10,10-trihydroxy-2,6-diimino-1H,8H-pyrrolo[1,2-c]purin-4-yl)methyl ester;
Gonyautoxin VI
Formula: C10H17N7O8S
Class: Natural Toxins
Gonyautoxin-6 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 595 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/30/2018 7:34:49 AM |
| InChI | InChI=1S/C10H17N7O8S/c11-6-13-5-4(3-25-8(18)15-26(22,23)24)17(21)7(12)16-2-1-9(19,20)10(5,16)14-6/h4-5,12,19-21H,1-3H2,(H,15,18)(H3,11,13,14)(H,22,23,24) |
| InChI Key | ALRRPAKWGUBPBK-UHFFFAOYSA-N |
| Canonical SMILES | C1CN2C(=N)N(C(C3C2(C1(O)O)NC(=N3)N)COC(=O)NS(=O)(=O)O)O |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, N-sulfo-, (octahydro-5,10,10-trihydroxy-2,6-diimino-1H,8H-pyrrolo[1,2-c]purin-4-yl)methyl ester; Gonyautoxin VI |
| Wikipedia | Gonyautoxin |
| PubChem | 15646822 |
| ChemSpider | 35013618 |
| HMDb | HMDB33512 |