Systematic / IUPAC Name: [(3aS,4R,10aS)-2,6-Diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methoxycarbonylsulfamic acid
ID: Reference8287
Other Names:
Carbamic acid, sulfo-, C-((2,6-diamino-3a,4,9,10-tetrahydro-10,10-dihydroxy-1H,8H-pyrrolo(1,2-c)purin-4-yl)methyl) ester, (3aS-(3aα,4α,10aR*))-;
Carbamic acid, sulfo-, C-(((3aS,4R,10aS)-2,6-diamino-3a,4,9,10-tetrahydro-10,10-dihydroxy-1H,8H-pyrrolo(1,2-c)purin-4-yl)methyl) ester;
Gonyautoxin V
Formula: C10H17N7O7S
Class: Natural Toxins
Gonyautoxin-5 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 508 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/30/2018 7:38:33 AM |
| InChI | InChI=1S/C10H17N7O7S/c11-6-14-5-4(3-24-8(18)16-25(21,22)23)13-7(12)17-2-1-9(19,20)10(5,17)15-6/h4-5,19-20H,1-3H2,(H2,12,13)(H,16,18)(H3,11,14,15)(H,21,22,23)/t4-,5-,10-/m0/s1 |
| InChI Key | JKKCSFJSULZNDN-HGRQIUPRSA-N |
| Canonical SMILES | C1CN2C(=NC(C3C2(C1(O)O)NC(=N3)N)COC(=O)NS(=O)(=O)O)N |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, sulfo-, C-((2,6-diamino-3a,4,9,10-tetrahydro-10,10-dihydroxy-1H,8H-pyrrolo(1,2-c)purin-4-yl)methyl) ester, (3aS-(3aα,4α,10aR*))-; Carbamic acid, sulfo-, C-(((3aS,4R,10aS)-2,6-diamino-3a,4,9,10-tetrahydro-10,10-dihydroxy-1H,8H-pyrrolo(1,2-c)purin-4-yl)methyl) ester; Gonyautoxin V |
| ChemIDPlus | 064296259; 122139780 |
| Wikipedia | Gonyautoxin |
| ChemSpider | 94743 |
| KEGG | C20018 |
| ChEMBL | CHEMBL496271 |
| PubChem | 104996 |