Systematic / IUPAC Name: 7H-Purine-6-thiol
ID: Reference8296
Other Names:
6-Mercaptoadenine;
6-Mercaptopurin;
6-Thiohypoxanthine;
9H-Purin-6-yl hydrosulfide;
Hypoxanthine, thio-
; more
Formula: C5H4N4S
Mercaptopurine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 148 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/5/2018 6:45:00 AM |
| InChI | InChI=1S/C5H4N4S/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) |
| InChI Key | GLVAUDGFNGKCSF-UHFFFAOYSA-N |
| Canonical SMILES | C1=NC2=C(N1)C(=S)N=CN2 |
| CAS | 50442 |
| Splash | |
| Other Names |
6-Mercaptoadenine; 6-Mercaptopurin; 6-Thiohypoxanthine; 9H-Purin-6-yl hydrosulfide; Hypoxanthine, thio-; Ismipur; Leukerin; Leupurin; Mercaleukim; Mercaleukin; Mercaptopurin; Mercaptopurina; Mercaptopurina wellcome; Mercaptopurinum; Mercapurin; Merkaptopuryna; Mern; Purimethol; Thiohypoxanthine; 1,7-Dihydro-6H-purine-6-thione; 1,9-Dihydro-6H-purine-6-thione; 1,9-Dihydropurine-6-thione; 1H-Purine, 6-mercapto-; 3,7-Dihydro-6H-purine-6-thione; 3,7-Dihydropurine-6-thione; 3H-Purine-6-thiol; 6 Mercaptopurine monohydrate; 6,7-Dihydro-3H-purine-6-thione; 6H-Purine-6-thione, 1,7-dihydro-; 6-Mercaptopurine; 6-Purinethiol; 6-Thiopurine; 6-Thioxopurine; 7-Mercapto-1,3,4,6-tetrazaindene; 9H-Purine-6(1H)-thione; 9H-Purine-6-thiol; H-Purine-6(1H)-thione; Mercaptopurine (6-MP); Mercaptopurine (van); Mercaptopurine anhydrous; Mercaptopurine, 6-; Purine antimetabolite: inhibits nucleic acid replication; Purine, 6-mercapto-; Purine-6(1H)-thione; Purine-6-thiol; Purinethiol; Purinethol; Purinethol;6-mercaptopurine;6-MP; Thiopurine |
| Wikipedia | Mercaptopurine |
| ChEMBL | CHEMBL1425 |
| ChemIDPlus | 000050442; 001194623; 007487936; 066626128; 50442 |
| DrugBank | DB01033; BI9878; DB01033 |
| PubChem | 667490 |
| ChEBI | CHEBI:2208; CHEBI:50667; CHEBI:94796 |
| HMDb | HMDB15167 |
| ChemSpider | 580869 |
| KEGG | C01756; C02380; D04931 |