Systematic / IUPAC Name: 2-(Oxiran-2-ylmethoxymethyl)oxirane
ID: Reference8311
Other Names:
DGE;
Diallyl ether dioxide;
Ether, diglycidyl;
Glycidyl ether;
Monoglycidyl ether
; more
Formula: C6H10O3
Class: Extractables/Leachables Textile Chemicals/Auxiliary/Dyes
Diglycidyl ether mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 175 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/13/2018 9:18:24 AM |
| InChI | InChI=1S/C6H10O3/c1(5-3-8-5)7-2-6-4-9-6/h5-6H,1-4H2 |
| InChI Key | GYZLOYUZLJXAJU-UHFFFAOYSA-N |
| Canonical SMILES | C1C(O1)COCC2CO2 |
| CAS | 2238075 |
| Splash | |
| Other Names |
DGE; Diallyl ether dioxide; Ether, diglycidyl; Glycidyl ether; Monoglycidyl ether; 1,2,6,7-Diepoxy-4-oxaheptane; 2-(Oxiran-2-ylmethoxymethyl)oxirane; 2,2'-(Oxybis(methylene))bisoxirane; Bis(2,3-epoxy-1 propyl) ether; Bis(2,3-epoxypropyl) ether; Bis-(2,3-epoxypropyl)ether; Diepoxy propyl ether; Ether, bis(2,3-epoxypropyl); Oxirane, 2,2'-[oxybis(methylene)]bis-; Oxirane,2,2'-[oxybis(methylene)]bis- |
| ChemIDPlus | 002238075; 2238075 |
| PubChem | 16704 |
| Wikipedia | Diglycidyl ether |
| ChemSpider | 15839 |