Systematic / IUPAC Name: 1,4-Dihydroxy-5,8-bis[(2-hydroxyethyl)amino]-9,10-anthraquinone
ID: Reference8317
Other Names:
BGH;
Acetate turquoise blue B;
Acetoquinone light green blue JL;
Amacel green blue B;
Amacel green blue G
; more
Formula: C18H18N2O6
Class: Extractables/Leachables Textile Chemicals/Auxiliary/Dyes
Disperse blue 7 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 456 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/13/2018 9:13:01 AM |
| InChI | InChI=1S/C18H18N2O6/c21-7-5-19-9-1-2-10(20-6-8-22)14-13(9)17(25)15-11(23)3-4-12(24)16(15)18(14)26/h1-4,19-24H,5-8H2 |
| InChI Key | WHPNHQRWWMLKPJ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C2C(=C1NCCO)C(=O)C3=C(C=CC(=C3C2=O)O)O)NCCO |
| CAS | 3179906 |
| Splash | |
| Other Names |
BGH; Acetate turquoise blue B; Acetoquinone light green blue JL; Amacel green blue B; Amacel green blue G; Artisil blue green GP; C I Disperse blue 7; C I Solvent blue 69; Celanthrene fast blue 2G; Celliton blue green B; Celliton fast blue green B; Celliton fast blue green BA-CF; Celutate green blue bgh; Cibacet blue green C; Cibacet blue green CB; Cibacet torquoise blue G; Cibacet turquoise blue 2G; Cibacet turquoise blue 4G; Cibacet turquoise blue G; Cibacete blue green C; Cilla fast blue green B; Diacelliton fast blue green B; Disperse blue green; Dispersive blue-green; Duranol blue green B; Duranol printing blue green B; Esteroquinone light blue 4JL; Fenacet fast turquoise B; Interchem acetate green blue alf; Interchem hisperse green blue alfh; Miketon fast turquoise blue G; Nacelan blue cbg; Nyloquinone blue 4J; Palanil blue 7G; Perliton blue green B; Samaron blue 5G; Seriplas blue green BW; Seriplas glue green BW; Serisol fast blue green B; Serisol fast blue green BW; Setacyl blue 6GN; Setacyl blue green P-BS; Setacyl turquoise blue 2G; Setacyl turquoise blue 4G; Setacyl turquoise blue G; Setacyl turquoise blue GD; Supracet blue green B; Supracet fast green blue B; Terasil blue green CB; Terasil turquoise blue G; Wln: L C666 BV ivj DQ GQ KM2Q NM2Q; 1,4-Bis((2-hydroxyethyl)amino)-5,8-dihydroxyanthraquinone; 1,4-Bis((β-hydroxyethyl)amino)-5,8-dihydroxyanthraquinone; 1,4-Dihydroxy-5,8-bis((2-hydroxyethyl)amino)-9,10-anthracenedione; 1,4-Dihydroxy-5,8-bis((2-hydroxyethyl)amino)anthraquinone; 1,4-Dihydroxy-5,8-bis(2-hydroxyethylamino)anthracene-9,10-dione; 1,4-Dihydroxy-5,8-bis[(2-hydroxyethyl)amino]anthra-9,10-quinone; 1,4-Dioh-5,8-bis[(2-ohethyl)amino]anthraquinone; 5,8-Dihydroxy-1,4-bis((2-hydroxyethyl)amino)anthraquinone; 9,10-Anthracenedione, 1,4-dihydroxy-5,8-bis[(2-hydroxyethyl)amino]-; Anthraquinone, 1,4-bis((2-hydroxyethyl)amino)-5,8-dihydroxy-; Anthraquinone, 1,4-dihydroxy-5,8-bis((2-hydroxyethyl)amino)- |
| ChemSpider | 17486 |
| ChemIDPlus | 003179906; 3179906 |
| ChEMBL | CHEMBL3248529 |
| PubChem | 18514 |