Systematic / IUPAC Name: N-(3-Fluorophenyl)-1-(2-phenylethyl)-4-piperidinamine
ID: Reference8341
Other Names:
Despropionyl m-fluorofentanyl;
4-Piperidinamine, N-(3-fluorophenyl)-1-(2-phenylethyl)-;
Despropionyl 3-FF;
Despropionyl m-FF
Formula: C19H23FN2
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
Despropionyl 3-fluorofentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/16/2018 10:50:36 AM |
| InChI | InChI=1S/C19H23FN2/c20-17-7-4-8-19(15-17)21-18-10-13-22(14-11-18)12-9-16-5-2-1-3-6-16/h1-8,15,18,21H,9-14H2 |
| InChI Key | NDGQTNDWAZPEQV-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCC1NC2=CC(=CC=C2)F)CCC3=CC=CC=C3 |
| CAS | 416881384 |
| Splash | |
| Other Names |
Despropionyl m-fluorofentanyl; 4-Piperidinamine, N-(3-fluorophenyl)-1-(2-phenylethyl)-; Despropionyl 3-FF; Despropionyl m-FF |
| PubChem | 23741730 |
| ChEMBL | CHEMBL1673260 |
| ChemSpider | 22493444 |