Systematic / IUPAC Name: 2-[(6-Chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)oxy]-1,1,2,2-tetrafluoroethanesulfonic acid
ID: Reference8384
Other Names:
Ethanesulfonic acid, 2-[(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)oxy]-1,1,2,2-tetrafluoro-;
9Cl-PF3ONS
Formula: C8HClF16O4S
Class: Extractables/Leachables Perfluorinated Hydrocarbons
9-Chlorohexadecafluoro-3-oxanonane-1-sulfonate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 198 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/27/2018 12:16:29 PM |
| InChI | InChI=1S/C8HClF16O4S/c9-5(18,19)3(14,15)1(10,11)2(12,13)4(16,17)6(20,21)29-7(22,23)8(24,25)30(26,27)28/h(H,26,27,28) |
| InChI Key | GGOUUEMCWBTDMT-UHFFFAOYSA-N |
| Canonical SMILES | C(C(C(C(F)(F)Cl)(F)F)(F)F)(C(C(OC(C(F)(F)S(=O)(=O)O)(F)F)(F)F)(F)F)(F)F |
| CAS | |
| Splash | |
| Other Names |
Ethanesulfonic acid, 2-[(6-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)oxy]-1,1,2,2-tetrafluoro-; 9Cl-PF3ONS |