Systematic / IUPAC Name: 2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoic acid
ID: Reference8385
Other Names:
GenX;
2-(Heptafluoropropoxy)-2,3,3,3-tetrafluoropropanoic acid;
2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoic acid;
Propanoic acid, 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-;
2-(Heptafluoropropoxy)-2,3,3,3-tetrafluoropropionic acid
; more
Formula: C6HF11O3
Class: Extractables/Leachables Perfluorinated Hydrocarbons
Hexafluoropropylene oxide dimer acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 133 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/26/2019 7:07:47 AM |
| InChI | InChI=1S/C6HF11O3/c7-2(1(18)19,4(10,11)12)20-6(16,17)3(8,9)5(13,14)15/h(H,18,19) |
| InChI Key | CSEBNABAWMZWIF-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F)O |
| CAS | |
| Splash | |
| Other Names |
GenX; 2-(Heptafluoropropoxy)-2,3,3,3-tetrafluoropropanoic acid; 2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoic acid; Propanoic acid, 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-; 2-(Heptafluoropropoxy)-2,3,3,3-tetrafluoropropionic acid; 2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propionic acid; Perfluoro(2-methyl-3-oxahexanoic)acid; Perfluoro-2-propoxypropionic acid; HFPO-DA |