Systematic / IUPAC Name: (4-Fluoronaphthalen-1-yl)(1-(5-hydroxypentyl)-1H-indol-3-yl)methanone
ID: Reference8402
Other Names: ?F2201 N-(5-hydroxypentyl) metabolite
Formula: C24H22FNO2
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
JWH 412 N-(5-hydroxypentyl) metabolite mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2018 8:08:59 AM |
| InChI | InChI=1S/C24H22FNO2/c25-22-13-12-20(17-8-2-3-9-18(17)22)24(28)21-16-26(14-6-1-7-15-27)23-11-5-4-10-19(21)23/h2-5,8-13,16,27H,1,6-7,14-15H2 |
| InChI Key | JIQKZFCDBLYORO-UHFFFAOYSA-N |
| Canonical SMILES | O=C(C1=CC=C(F)C2=C1C=CC=C2)C3=CN(C4=C3C=CC=C4)CCCCCO |
| CAS | |
| Splash | |
| Other Names | ?F2201 N-(5-hydroxypentyl) metabolite |
| Cayman | 17789 |