Systematic / IUPAC Name: N-(2-Methoxyphenyl)-N-(1-phenethylpiperidin-4-yl)butyramide
ID: Reference8410
Other Names:
2-MeO Butyryl fentanyl;
o-MeO Butyryl fentanyl;
ortho-MeO Butyryl fentanyl;
2-Methoxy butyryl fentanyl;
o-Methoxy butyryl fentanyl
Formula: C24H32N2O2
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
2-Methoxy butyryl fentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/5/2018 12:32:25 PM |
| InChI | InChI=1S/C24H32N2O2/c1-3-9-24(27)26(22-12-7-8-13-23(22)28-2)21-15-18-25(19-16-21)17-14-20-10-5-4-6-11-20/h4-8,10-13,21H,3,9,14-19H2,1-2H3 |
| InChI Key | RWKPKWZAKCWONI-UHFFFAOYSA-N |
| Canonical SMILES | O=C(CCC)N(C1CCN(CCc2ccccc2)CC1)c1c(OC)cccc1 |
| CAS | |
| Splash | |
| Other Names |
2-MeO Butyryl fentanyl; o-MeO Butyryl fentanyl; ortho-MeO Butyryl fentanyl; 2-Methoxy butyryl fentanyl; o-Methoxy butyryl fentanyl |
| Cayman | 22035 |