Systematic / IUPAC Name: trans-2-(2,4-dichlorophenyl)-N-2-(dimethylamino)cyclohexyl)-N-methylacetamide
ID: Reference8418
Other Names:
Formula: C17H24Cl2N2O
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
U-48800 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/7/2018 8:53:02 AM |
| InChI | InChI=1S/C17H24Cl2N2O/c1-20(2)15-6-4-5-7-16(15)21(3)17(22)10-12-8-9-13(18)11-14(12)19/h8-9,11,15-16H,4-7,10H2,1-3H3/t15-,16-/m0/s1 |
| InChI Key | FKUWIGXXBMULOI-HOTGVXAUSA-N |
| Canonical SMILES | CN(C)[C@H]1CCCC[C@@H]1N(C)C(=O)Cc1c(Cl)cc(Cl)cc1 |
| CAS | |
| Splash | |
| Other Names |
| Cayman | 22278 |