Systematic / IUPAC Name: N,α-Dimethyl-3-(trifluoromethyl)-benzeneethanamine
ID: Reference8424
Other Names: Phenethylamine, α,N-dimethyl-m-trifluoromethyl-
Formula: C11H14F3N
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
3-trifluoromethyl-N-Methylamphetamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/7/2018 9:38:33 AM |
| InChI | InChI=1S/C11H14F3N/c1-8(15-2)6-9-4-3-5-10(7-9)11(12,13)14/h3-5,7-8,15H,6H2,1-2H3 |
| InChI Key | WAUORSZPKUHOSM-UHFFFAOYSA-N |
| Canonical SMILES | CC(NC)Cc1cc(C(F)(F)F)ccc1 |
| CAS | |
| Splash | |
| Other Names | Phenethylamine, α,N-dimethyl-m-trifluoromethyl- |
| Cayman | 22492 |