Systematic / IUPAC Name: 5-Nitro-N-[3-(trifluoromethyl)phenyl]furan-2-carboxamide
ID: Reference8438
Other Names:
(5-Nitro(2-furyl))-N-[3-(trifluoromethyl)phenyl]carboxamide;
5-Nitro-furan-2-carboxylic acid (3-trifluoromethyl-phenyl)-amide;
5-Nitro-N-[3-(trifluoromethyl)phenyl]furan-2-carboxamide
Formula: C12H7F3N2O4
N2-[3-(Trifluoromethyl)phenyl]-5-nitro-2-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/11/2018 8:50:24 AM |
| InChI | InChI=1S/C12H7F3N2O4/c13-12(14,15)7-2-1-3-8(6-7)16-11(18)9-4-5-10(21-9)17(19)20/h1-6H,(H,16,18) |
| InChI Key | XRYAGGCLDGQPOK-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC=C(O2)[N+](=O)[O-])C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
(5-Nitro(2-furyl))-N-[3-(trifluoromethyl)phenyl]carboxamide; 5-Nitro-furan-2-carboxylic acid (3-trifluoromethyl-phenyl)-amide; 5-Nitro-N-[3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| ChemSpider | 662251 |
| ChEMBL | CHEMBL2313317 |
| PubChem | 757090 |