Systematic / IUPAC Name: Methyl 5-[(E)-({[(4-chlorophenyl)carbamoyl]oxy}imino)methyl]-1-(2,4-difluorophenyl)-1H-pyrazole-4-carboxylate
ID: Reference8457
Other Names: 1H-Pyrazole-4-carboxylic acid, 5-[(E)-[[[[(4-chlorophenyl)amino]carbonyl]oxy]imino]methyl]-1-(2,4-difluorophenyl)-, methyl ester
Formula: C19H13ClF2N4O4
Methyl 5-[({[(4-chloroanilino)carbonyl]oxy}imino)methyl]-1-(2,4-difluorophenyl)-1H-pyrazole-4-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/12/2018 10:56:41 AM |
| InChI | InChI=1S/C19H13ClF2N4O4/c1-29-18(27)14-9-23-26(16-7-4-12(21)8-15(16)22)17(14)10-24-30-19(28)25-13-5-2-11(20)3-6-13/h2-10H,1H3,(H,25,28)/b24-10+ |
| InChI Key | LZZYJYYLAUSNQG-YSURURNPSA-N |
| Canonical SMILES | COC(=O)C1=C(N(N=C1)C2=C(C=C(C=C2)F)F)C=NOC(=O)NC3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names | 1H-Pyrazole-4-carboxylic acid, 5-[(E)-[[[[(4-chlorophenyl)amino]carbonyl]oxy]imino]methyl]-1-(2,4-difluorophenyl)-, methyl ester |