Systematic / IUPAC Name: 1-(3-Chlorophenyl)-3-{3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl}urea
ID: Reference8459
Other Names: Urea, N-(3-chlorophenyl)-N'-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]-
Formula: C16H10ClF3N4O3
N-(3-Chlorophenyl)-N'-{3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl}urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 74 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/12/2018 11:42:06 AM |
| InChI | InChI=1S/C16H10ClF3N4O3/c17-10-2-1-3-11(8-10)21-14(25)23-15-22-13(24-27-15)9-4-6-12(7-5-9)26-16(18,19)20/h1-8H,(H2,21,22,23,24,25) |
| InChI Key | PXMJEXQDNGWQEX-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC(=C1)Cl)NC(=O)NC2=NC(=NO2)C3=CC=C(C=C3)OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Urea, N-(3-chlorophenyl)-N'-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]- |